| Name | capric acid sodium salt |
| Synonyms | SODIUM DECANOATE capric acid sodium sodiumdecanoicacid caprinicacidsodiumsalt CAPRIC ACID SODIUM SALT capric acid sodium salt N-CAPRIC ACID SODIUM SALT DECANOIC ACID SODIUM SALT N-DECANOIC ACID SODIUM SALT |
| CAS | 1002-62-6 |
| EINECS | 213-688-4 |
| InChI | InChI=1/C10H20O2.Na/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1 |
| Molecular Formula | C10H19NaO2 |
| Molar Mass | 194.25 |
| Melting Point | ~240°C (dec.) |
| Boling Point | 269.6°C at 760 mmHg |
| Flash Point | 121.8°C |
| Water Solubility | very faint turbidity |
| Solubility | H2O: 0.1g/mL, clear, colorless |
| Vapor Presure | 0.00355mmHg at 25°C |
| Appearance | White powder |
| Color | White to Light yellow |
| BRN | 3572742 |
| Storage Condition | 2-8°C |
| MDL | MFCD00066453 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | HE0200000 |
| Reference Show more | 1. Zhang Haoyue, Guo Zhengyan, Lu Zhitang, Chen Yihua. Response surface methodology was applied to optimize fermentation medium to improve the yield of tolubicin [J]. Microbiology Bulletin, 2021,48(01):113-122. |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |